C22H20N4O5S — CID 153205008
2-(2,6-dioxopiperidin-3-yl)-5-[3-(6-ethylsulfanylpyridazin-3-yl)-3-oxopropyl]isoindole-1,3-dione (PubChem CID 153205008) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-(6-ethylsulfanylpyridazin-3-yl)-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-(6-ethylsulfanylpyridazin-3-yl)-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 153205008 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-(6-ethylsulfanylpyridazin-3-yl)-3-oxopropyl]isoindole-1,3-dione |
| SMILES | CCSc1ccc(C(=O)CCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)nn1 |
| InChI | InChI=1S/C22H20N4O5S/c1-2-32-19-10-6-15(24-25-19)17(27)8-4-12-3-5-13-14(11-12)22(31)26(21(13)30)16-7-9-18(28)23-20(16)29/h3,5-6,10-11,16H,2,4,7-9H2,1H3,(H,23,28,29) |
| InChIKey | WKQMVJSVYKVANP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|