C22H19N3O7S — CID 158125813
2-(2,6-dioxopiperidin-3-yl)-5-[3-(5-methylsulfonyl-2-pyridinyl)-3-oxopropyl]isoindole-1,3-dione (PubChem CID 158125813) has the molecular formula C22H19N3O7S and a molecular weight of 469.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-(5-methylsulfonyl-2-pyridinyl)-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-(5-methylsulfonyl-2-pyridinyl)-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158125813 |
| Molecular Formula | C22H19N3O7S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-(5-methylsulfonyl-2-pyridinyl)-3-oxopropyl]isoindole-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc(C(=O)CCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)nc1 |
| InChI | InChI=1S/C22H19N3O7S/c1-33(31,32)13-4-6-16(23-11-13)18(26)8-3-12-2-5-14-15(10-12)22(30)25(21(14)29)17-7-9-19(27)24-20(17)28/h2,4-6,10-11,17H,3,7-9H2,1H3,(H,24,27,28) |
| InChIKey | FSDSCEDCJRSGGA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|