C24H22N4O7 — CID 134414054
6-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]azetidin-1-yl]pyridine-3-carboxylic acid (PubChem CID 134414054) has the molecular formula C24H22N4O7 and a molecular weight of 478.46 g/mol. Its IUPAC name is 6-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]azetidin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]azetidin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 134414054 |
| Molecular Formula | C24H22N4O7 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 6-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethyl]azetidin-1-yl]pyridine-3-carboxylic acid |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCC4CN(c5ccc(C(=O)O)cn5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H22N4O7/c29-20-6-4-18(21(30)26-20)28-22(31)16-3-2-15(9-17(16)23(28)32)35-8-7-13-11-27(12-13)19-5-1-14(10-25-19)24(33)34/h1-3,5,9-10,13,18H,4,6-8,11-12H2,(H,33,34)(H,26,29,30) |
| InChIKey | XWITVWBPFRHRMC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 146.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|