C26H28N4O6 — CID 167041250
1-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypropyl]cyclohexyl]pyrazole-3-carbaldehyde (PubChem CID 167041250) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is 1-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypropyl]cyclohexyl]pyrazole-3-carbaldehyde.
| Compound Name | 1-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypropyl]cyclohexyl]pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 167041250 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 1-[4-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypropyl]cyclohexyl]pyrazole-3-carbaldehyde |
| SMILES | O=Cc1ccn(C2CCC(CCCOc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)n1 |
| InChI | InChI=1S/C26H28N4O6/c31-15-17-11-12-29(28-17)18-5-3-16(4-6-18)2-1-13-36-19-7-8-20-21(14-19)26(35)30(25(20)34)22-9-10-23(32)27-24(22)33/h7-8,11-12,14-16,18,22H,1-6,9-10,13H2,(H,27,32,33) |
| InChIKey | GRMMVFVDKHUNAI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|