C15H16N4O3 — CID 135273255
3-[4-methyl-3-(4-methylphenyl)-5-oxo-1,2,4-triazol-1-yl]piperidine-2,6-dione (PubChem CID 135273255) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 3-[4-methyl-3-(4-methylphenyl)-5-oxo-1,2,4-triazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-methyl-3-(4-methylphenyl)-5-oxo-1,2,4-triazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 135273255 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-[4-methyl-3-(4-methylphenyl)-5-oxo-1,2,4-triazol-1-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(-c2nn(C3CCC(=O)NC3=O)c(=O)n2C)cc1 |
| InChI | InChI=1S/C15H16N4O3/c1-9-3-5-10(6-4-9)13-17-19(15(22)18(13)2)11-7-8-12(20)16-14(11)21/h3-6,11H,7-8H2,1-2H3,(H,16,20,21) |
| InChIKey | GJBJIVNHSDOCLP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|