C8H9BrN4O3 — CID 142409714
3-(3-bromo-4-methyl-5-oxo-1,2,4-triazol-1-yl)piperidine-2,6-dione (PubChem CID 142409714) has the molecular formula C8H9BrN4O3 and a molecular weight of 289.09 g/mol. Its IUPAC name is 3-(3-bromo-4-methyl-5-oxo-1,2,4-triazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(3-bromo-4-methyl-5-oxo-1,2,4-triazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 142409714 |
| Molecular Formula | C8H9BrN4O3 |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 3-(3-bromo-4-methyl-5-oxo-1,2,4-triazol-1-yl)piperidine-2,6-dione |
| SMILES | Cn1c(Br)nn(C2CCC(=O)NC2=O)c1=O |
| InChI | InChI=1S/C8H9BrN4O3/c1-12-7(9)11-13(8(12)16)4-2-3-5(14)10-6(4)15/h4H,2-3H2,1H3,(H,10,14,15) |
| InChIKey | IDYRAASPMBQJRR-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|