C9H10BrN3O2 — CID 175460530
3-(6-bromo-2H-pyrimidin-1-yl)piperidine-2,6-dione (PubChem CID 175460530) has the molecular formula C9H10BrN3O2 and a molecular weight of 272.10 g/mol. Its IUPAC name is 3-(6-bromo-2H-pyrimidin-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-bromo-2H-pyrimidin-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 175460530 |
| Molecular Formula | C9H10BrN3O2 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 3-(6-bromo-2H-pyrimidin-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2CN=CC=C2Br)C(=O)N1 |
| InChI | InChI=1S/C9H10BrN3O2/c10-7-3-4-11-5-13(7)6-1-2-8(14)12-9(6)15/h3-4,6H,1-2,5H2,(H,12,14,15) |
| InChIKey | SZZWYKYZLDFLFL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|