C8H8BrN3O2 — CID 135273234
3-(4-bromopyrazol-1-yl)piperidine-2,6-dione (PubChem CID 135273234) has the molecular formula C8H8BrN3O2 and a molecular weight of 258.07 g/mol. Its IUPAC name is 3-(4-bromopyrazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-bromopyrazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 135273234 |
| Molecular Formula | C8H8BrN3O2 |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 3-(4-bromopyrazol-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cc(Br)cn2)C(=O)N1 |
| InChI | InChI=1S/C8H8BrN3O2/c9-5-3-10-12(4-5)6-1-2-7(13)11-8(6)14/h3-4,6H,1-2H2,(H,11,13,14) |
| InChIKey | CFUCLJIOSMCTCA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|