C17H17BrN4O2S2 — CID 175493443
4-bromo-2-methylthiophene;3-[4-(5-methylthiophen-3-yl)triazol-1-yl]piperidine-2,6-dione (PubChem CID 175493443) has the molecular formula C17H17BrN4O2S2 and a molecular weight of 453.39 g/mol. Its IUPAC name is 4-bromo-2-methylthiophene;3-[4-(5-methylthiophen-3-yl)triazol-1-yl]piperidine-2,6-dione.
| Compound Name | 4-bromo-2-methylthiophene;3-[4-(5-methylthiophen-3-yl)triazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175493443 |
| Molecular Formula | C17H17BrN4O2S2 |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | 4-bromo-2-methylthiophene;3-[4-(5-methylthiophen-3-yl)triazol-1-yl]piperidine-2,6-dione |
| SMILES | Cc1cc(-c2cn(C3CCC(=O)NC3=O)nn2)cs1.Cc1cc(Br)cs1 |
| InChI | InChI=1S/C12H12N4O2S.C5H5BrS/c1-7-4-8(6-19-7)9-5-16(15-14-9)10-2-3-11(17)13-12(10)18;1-4-2-5(6)3-7-4/h4-6,10H,2-3H2,1H3,(H,13,17,18);2-3H,1H3 |
| InChIKey | SZJAWMJMKGGFJL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|