C19H16BrFN4O — CID 90937145
3-[4-(4-bromophenyl)triazol-1-yl]-6-(1-fluorobut-1-en-3-ynyl)-7-methyl-1,3,4,5-tetrahydroazepin-2-one (PubChem CID 90937145) has the molecular formula C19H16BrFN4O and a molecular weight of 415.27 g/mol. Its IUPAC name is 3-[4-(4-bromophenyl)triazol-1-yl]-6-(1-fluorobut-1-en-3-ynyl)-7-methyl-1,3,4,5-tetrahydroazepin-2-one.
| Compound Name | 3-[4-(4-bromophenyl)triazol-1-yl]-6-(1-fluorobut-1-en-3-ynyl)-7-methyl-1,3,4,5-tetrahydroazepin-2-one |
|---|---|
| PubChem CID | 90937145 |
| Molecular Formula | C19H16BrFN4O |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 3-[4-(4-bromophenyl)triazol-1-yl]-6-(1-fluorobut-1-en-3-ynyl)-7-methyl-1,3,4,5-tetrahydroazepin-2-one |
| SMILES | C#CC=C(F)C1=C(C)NC(=O)C(n2cc(-c3ccc(Br)cc3)nn2)CC1 |
| InChI | InChI=1S/C19H16BrFN4O/c1-3-4-16(21)15-9-10-18(19(26)22-12(15)2)25-11-17(23-24-25)13-5-7-14(20)8-6-13/h1,4-8,11,18H,9-10H2,2H3,(H,22,26) |
| InChIKey | ZODTYJMBQJSIQZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|