C12H16N4O4 — CID 166431054
ethyl 3-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]propanoate (PubChem CID 166431054) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is ethyl 3-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]propanoate.
| Compound Name | ethyl 3-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]propanoate |
|---|---|
| PubChem CID | 166431054 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | ethyl 3-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1cn(C2CCC(=O)NC2=O)nn1 |
| InChI | InChI=1S/C12H16N4O4/c1-2-20-11(18)6-3-8-7-16(15-14-8)9-4-5-10(17)13-12(9)19/h7,9H,2-6H2,1H3,(H,13,17,19) |
| InChIKey | HHZRGSLFFYHITQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|