C20H17N5O4S — CID 177059959
N-[[4-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]thiophen-2-yl]methyl]-4-formylbenzamide (PubChem CID 177059959) has the molecular formula C20H17N5O4S and a molecular weight of 423.45 g/mol. Its IUPAC name is N-[[4-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]thiophen-2-yl]methyl]-4-formylbenzamide.
| Compound Name | N-[[4-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]thiophen-2-yl]methyl]-4-formylbenzamide |
|---|---|
| PubChem CID | 177059959 |
| Molecular Formula | C20H17N5O4S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[[4-[1-(2,6-dioxopiperidin-3-yl)triazol-4-yl]thiophen-2-yl]methyl]-4-formylbenzamide |
| SMILES | O=Cc1ccc(C(=O)NCc2cc(-c3cn(C4CCC(=O)NC4=O)nn3)cs2)cc1 |
| InChI | InChI=1S/C20H17N5O4S/c26-10-12-1-3-13(4-2-12)19(28)21-8-15-7-14(11-30-15)16-9-25(24-23-16)17-5-6-18(27)22-20(17)29/h1-4,7,9-11,17H,5-6,8H2,(H,21,28)(H,22,27,29) |
| InChIKey | MNJBPHKJGRMZFO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|