C21H20N6O5 — CID 167826196
2-(2,6-dioxopiperidin-3-yl)-5-[1-(2-oxoazepan-3-yl)triazol-4-yl]isoindole-1,3-dione (PubChem CID 167826196) has the molecular formula C21H20N6O5 and a molecular weight of 436.43 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[1-(2-oxoazepan-3-yl)triazol-4-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[1-(2-oxoazepan-3-yl)triazol-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167826196 |
| Molecular Formula | C21H20N6O5 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[1-(2-oxoazepan-3-yl)triazol-4-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(-c4cn(C5CCCCNC5=O)nn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H20N6O5/c28-17-7-6-16(19(30)23-17)27-20(31)12-5-4-11(9-13(12)21(27)32)14-10-26(25-24-14)15-3-1-2-8-22-18(15)29/h4-5,9-10,15-16H,1-3,6-8H2,(H,22,29)(H,23,28,30) |
| InChIKey | GKVIHVNFNVPAEO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 143.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|