C21H16N6O6S — CID 167956148
3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]triazol-1-yl]benzenesulfonamide (PubChem CID 167956148) has the molecular formula C21H16N6O6S and a molecular weight of 480.46 g/mol. Its IUPAC name is 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]triazol-1-yl]benzenesulfonamide.
| Compound Name | 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]triazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 167956148 |
| Molecular Formula | C21H16N6O6S |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 3-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]triazol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-n2cc(-c3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)nn2)c1 |
| InChI | InChI=1S/C21H16N6O6S/c22-34(32,33)13-3-1-2-12(9-13)26-10-16(24-25-26)11-4-5-14-15(8-11)21(31)27(20(14)30)17-6-7-18(28)23-19(17)29/h1-5,8-10,17H,6-7H2,(H2,22,32,33)(H,23,28,29) |
| InChIKey | DYPLMXIJDBVASD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 174.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|