C21H13ClFN5O4 — CID 167954513
5-[1-(3-chloro-2-fluorophenyl)triazol-4-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167954513) has the molecular formula C21H13ClFN5O4 and a molecular weight of 453.82 g/mol. Its IUPAC name is 5-[1-(3-chloro-2-fluorophenyl)triazol-4-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[1-(3-chloro-2-fluorophenyl)triazol-4-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167954513 |
| Molecular Formula | C21H13ClFN5O4 |
| Molecular Weight | 453.82 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 5-[1-(3-chloro-2-fluorophenyl)triazol-4-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(-c4cn(-c5cccc(Cl)c5F)nn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H13ClFN5O4/c22-13-2-1-3-15(18(13)23)27-9-14(25-26-27)10-4-5-11-12(8-10)21(32)28(20(11)31)16-6-7-17(29)24-19(16)30/h1-5,8-9,16H,6-7H2,(H,24,29,30) |
| InChIKey | YBUDCIPGMLSNLT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.82 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|