C26H23N5O5 — CID 167797897
4-[4-(4-cyclopentyloxyphenyl)triazol-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167797897) has the molecular formula C26H23N5O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is 4-[4-(4-cyclopentyloxyphenyl)triazol-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[4-(4-cyclopentyloxyphenyl)triazol-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167797897 |
| Molecular Formula | C26H23N5O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 4-[4-(4-cyclopentyloxyphenyl)triazol-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(-n4cc(-c5ccc(OC6CCCC6)cc5)nn4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H23N5O5/c32-22-13-12-21(24(33)27-22)31-25(34)18-6-3-7-20(23(18)26(31)35)30-14-19(28-29-30)15-8-10-17(11-9-15)36-16-4-1-2-5-16/h3,6-11,14,16,21H,1-2,4-5,12-13H2,(H,27,32,33) |
| InChIKey | IVDPQPVGTUCEKX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|