C21H15N5O5 — CID 164946917
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]indazole-7-carboxamide (PubChem CID 164946917) has the molecular formula C21H15N5O5 and a molecular weight of 417.38 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]indazole-7-carboxamide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 164946917 |
| Molecular Formula | C21H15N5O5 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]indazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2cn(-c3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)nc12 |
| InChI | InChI=1S/C21H15N5O5/c22-18(28)12-5-1-3-10-9-25(24-17(10)12)13-6-2-4-11-16(13)21(31)26(20(11)30)14-7-8-15(27)23-19(14)29/h1-6,9,14H,7-8H2,(H2,22,28)(H,23,27,29) |
| InChIKey | HRZMFKDVIIZTLW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|