C33H29FN6O5 — CID 168872195
2-[4-[(3S)-1-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]methyl]piperidin-3-yl]phenyl]indazole-7-carboxamide (PubChem CID 168872195) has the molecular formula C33H29FN6O5 and a molecular weight of 608.63 g/mol. Its IUPAC name is 2-[4-[(3S)-1-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]methyl]piperidin-3-yl]phenyl]indazole-7-carboxamide.
| Compound Name | 2-[4-[(3S)-1-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]methyl]piperidin-3-yl]phenyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 168872195 |
| Molecular Formula | C33H29FN6O5 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | 2-[4-[(3S)-1-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1,3-dioxoisoindol-5-yl]methyl]piperidin-3-yl]phenyl]indazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2cn(-c3ccc([C@@H]4CCCN(Cc5cc6c(cc5F)C(=O)N(C5CCC(=O)NC5=O)C6=O)C4)cc3)nc12 |
| InChI | InChI=1S/C33H29FN6O5/c34-26-14-25-24(32(44)40(33(25)45)27-10-11-28(41)36-31(27)43)13-21(26)16-38-12-2-4-19(15-38)18-6-8-22(9-7-18)39-17-20-3-1-5-23(30(35)42)29(20)37-39/h1,3,5-9,13-14,17,19,27H,2,4,10-12,15-16H2,(H2,35,42)(H,36,41,43)/t19-,27?/m1/s1 |
| InChIKey | CXOJCDFKEZSAPF-FOEZPWHWSA-N |
| XLogP | 3.04 |
| TPSA | 147.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|