C21H26N4O — CID 176571066
ethane;2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide (PubChem CID 176571066) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is ethane;2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide.
| Compound Name | ethane;2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 176571066 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | ethane;2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide |
| SMILES | CC.NC(=O)c1cccc2cn(-c3ccc([C@@H]4CCCNC4)cc3)nc12 |
| InChI | InChI=1S/C19H20N4O.C2H6/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14;1-2/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24);1-2H3/t14-;/m1./s1 |
| InChIKey | DATHWSCJXMNBDA-PFEQFJNWSA-N |
| XLogP | 3.62 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |