C19H19IN4O — CID 166999995
2-[4-[(3S)-1-iodopiperidin-3-yl]phenyl]indazole-7-carboxamide (PubChem CID 166999995) has the molecular formula C19H19IN4O and a molecular weight of 446.29 g/mol. Its IUPAC name is 2-[4-[(3S)-1-iodopiperidin-3-yl]phenyl]indazole-7-carboxamide.
| Compound Name | 2-[4-[(3S)-1-iodopiperidin-3-yl]phenyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 166999995 |
| Molecular Formula | C19H19IN4O |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 2-[4-[(3S)-1-iodopiperidin-3-yl]phenyl]indazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2cn(-c3ccc([C@@H]4CCCN(I)C4)cc3)nc12 |
| InChI | InChI=1S/C19H19IN4O/c20-23-10-2-4-14(11-23)13-6-8-16(9-7-13)24-12-15-3-1-5-17(19(21)25)18(15)22-24/h1,3,5-9,12,14H,2,4,10-11H2,(H2,21,25)/t14-/m1/s1 |
| InChIKey | OUSONGHZGJNNFG-CQSZACIVSA-N |
| XLogP | 3.65 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|