C24H25BN4O5 — CID 161313460
CID 161313460 (PubChem CID 161313460) has the molecular formula C24H25BN4O5 and a molecular weight of 461.31 g/mol.
| Compound Name | CID 161313460 |
|---|---|
| PubChem CID | 161313460 |
| Molecular Formula | C24H25BN4O5 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | — |
| SMILES | [2H]C([B])OC(=O)CC(=O)OCN1CCC[C@@H](c2ccc(-n3cc4cccc(C(N)=O)c4n3)cc2)C1 |
| InChI | InChI=1S/C24H25BN4O5/c25-14-33-21(30)11-22(31)34-15-28-10-2-4-17(12-28)16-6-8-19(9-7-16)29-13-18-3-1-5-20(24(26)32)23(18)27-29/h1,3,5-9,13,17H,2,4,10-12,14-15H2,(H2,26,32)/t17-/m1/s1/i14D/t14?,17- |
| InChIKey | WCHQLLZDNLBXJW-JUFZVQPUSA-N |
| XLogP | 1.86 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|