C39H48N4O2 — CID 123137800
2-[4-(1-icosa-5,8,11,14,17-pentaenoylpiperidin-3-yl)phenyl]indazole-7-carboxamide (PubChem CID 123137800) has the molecular formula C39H48N4O2 and a molecular weight of 604.84 g/mol. Its IUPAC name is 2-[4-(1-icosa-5,8,11,14,17-pentaenoylpiperidin-3-yl)phenyl]indazole-7-carboxamide.
| Compound Name | 2-[4-(1-icosa-5,8,11,14,17-pentaenoylpiperidin-3-yl)phenyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 123137800 |
| Molecular Formula | C39H48N4O2 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | 2-[4-(1-icosa-5,8,11,14,17-pentaenoylpiperidin-3-yl)phenyl]indazole-7-carboxamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)N1CCCC(c2ccc(-n3cc4cccc(C(N)=O)c4n3)cc2)C1 |
| InChI | InChI=1S/C39H48N4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-37(44)42-29-20-22-33(30-42)32-25-27-35(28-26-32)43-31-34-21-19-23-36(39(40)45)38(34)41-43/h3-4,6-7,9-10,12-13,15-16,19,21,23,25-28,31,33H,2,5,8,11,14,17-18,20,22,24,29-30H2,1H3,(H2,40,45) |
| InChIKey | BUTKIPCSYAXCFM-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|