About 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide
2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide (PubChem CID 154588339) has the molecular formula C19H20N4O
and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide.
Molecular Properties
| Compound Name | 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide |
| PubChem CID | 154588339 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide |
| SMILES | [2H]C1([2H])NCCCC1c1ccc(-n2cc3cccc(C(N)=O)c3n2)cc1 |
| InChI | InChI=1S/C19H20N4O/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24)/i11D2 |
| InChIKey | PCHKPVIQAHNQLW-ZWGOZCLVSA-N |
| XLogP | 2.59 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide?
The IUPAC name of 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide (CID 154588339) is 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide.
What is the SMILES notation for 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide?
The canonical SMILES for 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide is [2H]C1([2H])NCCCC1c1ccc(-n2cc3cccc(C(N)=O)c3n2)cc1.
What is the InChIKey of 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide?
The InChIKey is PCHKPVIQAHNQLW-ZWGOZCLVSA-N. The full InChI is InChI=1S/C19H20N4O/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24)/i11D2.
What are the key properties of 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide?
2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide has a molecular weight of 322.41 g/mol, XLogP of 2.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,2-dideuteriopiperidin-3-yl)phenyl]indazole-7-carboxamide is sourced from PubChem (CID 154588339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).