C22H23F3N4O3 — CID 118451760
2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide;3,3,3-trifluoropropanoic acid (PubChem CID 118451760) has the molecular formula C22H23F3N4O3 and a molecular weight of 448.45 g/mol. Its IUPAC name is 2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide;3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide;3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 118451760 |
| Molecular Formula | C22H23F3N4O3 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-[4-[(3S)-piperidin-3-yl]phenyl]indazole-7-carboxamide;3,3,3-trifluoropropanoic acid |
| SMILES | NC(=O)c1cccc2cn(-c3ccc([C@@H]4CCCNC4)cc3)nc12.O=C(O)CC(F)(F)F |
| InChI | InChI=1S/C19H20N4O.C3H3F3O2/c20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14;4-3(5,6)1-2(7)8/h1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24);1H2,(H,7,8)/t14-;/m1./s1 |
| InChIKey | UVVGIZVORWCLLX-PFEQFJNWSA-N |
| XLogP | 3.61 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |