C19H19FN4O — CID 24958203
5-fluoro-2-[4-[(3R)-piperidin-3-yl]phenyl]indazole-7-carboxamide (PubChem CID 24958203) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is 5-fluoro-2-[4-[(3R)-piperidin-3-yl]phenyl]indazole-7-carboxamide.
| Compound Name | 5-fluoro-2-[4-[(3R)-piperidin-3-yl]phenyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 24958203 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 5-fluoro-2-[4-[(3R)-piperidin-3-yl]phenyl]indazole-7-carboxamide |
| SMILES | NC(=O)c1cc(F)cc2cn(-c3ccc([C@H]4CCCNC4)cc3)nc12 |
| InChI | InChI=1S/C19H19FN4O/c20-15-8-14-11-24(23-18(14)17(9-15)19(21)25)16-5-3-12(4-6-16)13-2-1-7-22-10-13/h3-6,8-9,11,13,22H,1-2,7,10H2,(H2,21,25)/t13-/m0/s1 |
| InChIKey | SXEMEOZJVFGBKZ-ZDUSSCGKSA-N |
| XLogP | 2.73 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |