C32H30FN7O4 — CID 168872387
2-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]piperazin-1-yl]phenyl]indazole-7-carboxamide (PubChem CID 168872387) has the molecular formula C32H30FN7O4 and a molecular weight of 595.64 g/mol. Its IUPAC name is 2-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]piperazin-1-yl]phenyl]indazole-7-carboxamide.
| Compound Name | 2-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]piperazin-1-yl]phenyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 168872387 |
| Molecular Formula | C32H30FN7O4 |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 2-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-6-fluoro-1-oxo-3H-isoindol-5-yl]methyl]piperazin-1-yl]phenyl]indazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2cn(-c3ccc(N4CCN(Cc5cc6c(cc5F)C(=O)N(C5CCC(=O)NC5=O)C6)CC4)cc3)nc12 |
| InChI | InChI=1S/C32H30FN7O4/c33-26-15-25-20(17-39(32(25)44)27-8-9-28(41)35-31(27)43)14-21(26)16-37-10-12-38(13-11-37)22-4-6-23(7-5-22)40-18-19-2-1-3-24(30(34)42)29(19)36-40/h1-7,14-15,18,27H,8-13,16-17H2,(H2,34,42)(H,35,41,43) |
| InChIKey | YAXVJZXRXHOHLJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|