C23H19N5O5 — CID 167968292
2-(2,6-dioxopiperidin-3-yl)-5-[4-(1-hydroxy-2-phenylethyl)triazol-1-yl]isoindole-1,3-dione (PubChem CID 167968292) has the molecular formula C23H19N5O5 and a molecular weight of 445.44 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-(1-hydroxy-2-phenylethyl)triazol-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-(1-hydroxy-2-phenylethyl)triazol-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167968292 |
| Molecular Formula | C23H19N5O5 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-(1-hydroxy-2-phenylethyl)triazol-1-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(-n4cc(C(O)Cc5ccccc5)nn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H19N5O5/c29-19(10-13-4-2-1-3-5-13)17-12-27(26-25-17)14-6-7-15-16(11-14)23(33)28(22(15)32)18-8-9-20(30)24-21(18)31/h1-7,11-12,18-19,29H,8-10H2,(H,24,30,31) |
| InChIKey | HEUZVIDPWDUWHL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|