C15H10F6N4O2 — CID 132542942
3-[4-[3,5-bis(trifluoromethyl)phenyl]triazol-1-yl]piperidine-2,6-dione (PubChem CID 132542942) has the molecular formula C15H10F6N4O2 and a molecular weight of 392.26 g/mol. Its IUPAC name is 3-[4-[3,5-bis(trifluoromethyl)phenyl]triazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[3,5-bis(trifluoromethyl)phenyl]triazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 132542942 |
| Molecular Formula | C15H10F6N4O2 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 3-[4-[3,5-bis(trifluoromethyl)phenyl]triazol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nn2)C(=O)N1 |
| InChI | InChI=1S/C15H10F6N4O2/c16-14(17,18)8-3-7(4-9(5-8)15(19,20)21)10-6-25(24-23-10)11-1-2-12(26)22-13(11)27/h3-6,11H,1-2H2,(H,22,26,27) |
| InChIKey | LPXDXTBQQWRVEG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|