C19H21F6N4+ — CID 57340861
(1S,5R)-3-[4-[3,5-bis(trifluoromethyl)phenyl]triazol-1-yl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane (PubChem CID 57340861) has the molecular formula C19H21F6N4+ and a molecular weight of 419.39 g/mol. Its IUPAC name is (1S,5R)-3-[4-[3,5-bis(trifluoromethyl)phenyl]triazol-1-yl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane.
| Compound Name | (1S,5R)-3-[4-[3,5-bis(trifluoromethyl)phenyl]triazol-1-yl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 57340861 |
| Molecular Formula | C19H21F6N4+ |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (1S,5R)-3-[4-[3,5-bis(trifluoromethyl)phenyl]triazol-1-yl]-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(n1cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nn1)C2 |
| InChI | InChI=1S/C19H21F6N4/c1-29(2)15-3-4-16(29)9-14(8-15)28-10-17(26-27-28)11-5-12(18(20,21)22)7-13(6-11)19(23,24)25/h5-7,10,14-16H,3-4,8-9H2,1-2H3/q+1/t14?,15-,16+ |
| InChIKey | PPYDHVDMMAYDDI-MQVJKMGUSA-N |
| XLogP | 4.93 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|