C16H19FN4 — CID 70674996
(3R)-3-[4-[4-(fluoromethyl)phenyl]triazol-1-yl]-1-azabicyclo[2.2.2]octane (PubChem CID 70674996) has the molecular formula C16H19FN4 and a molecular weight of 286.35 g/mol. Its IUPAC name is (3R)-3-[4-[4-(fluoromethyl)phenyl]triazol-1-yl]-1-azabicyclo[2.2.2]octane.
| Compound Name | (3R)-3-[4-[4-(fluoromethyl)phenyl]triazol-1-yl]-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 70674996 |
| Molecular Formula | C16H19FN4 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (3R)-3-[4-[4-(fluoromethyl)phenyl]triazol-1-yl]-1-azabicyclo[2.2.2]octane |
| SMILES | FCc1ccc(-c2cn([C@H]3CN4CCC3CC4)nn2)cc1 |
| InChI | InChI=1S/C16H19FN4/c17-9-12-1-3-13(4-2-12)15-10-21(19-18-15)16-11-20-7-5-14(16)6-8-20/h1-4,10,14,16H,5-9,11H2/t16-/m0/s1 |
| InChIKey | JAGLBDLYYJYLOE-INIZCTEOSA-N |
| XLogP | 2.68 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |