C19H20N4S — CID 70981645
(3R)-3-[4-(4-thiophen-2-ylphenyl)triazol-1-yl]-1-azabicyclo[2.2.2]octane (PubChem CID 70981645) has the molecular formula C19H20N4S and a molecular weight of 336.46 g/mol. Its IUPAC name is (3R)-3-[4-(4-thiophen-2-ylphenyl)triazol-1-yl]-1-azabicyclo[2.2.2]octane.
| Compound Name | (3R)-3-[4-(4-thiophen-2-ylphenyl)triazol-1-yl]-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 70981645 |
| Molecular Formula | C19H20N4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (3R)-3-[4-(4-thiophen-2-ylphenyl)triazol-1-yl]-1-azabicyclo[2.2.2]octane |
| SMILES | c1csc(-c2ccc(-c3cn([C@H]4CN5CCC4CC5)nn3)cc2)c1 |
| InChI | InChI=1S/C19H20N4S/c1-2-19(24-11-1)16-5-3-14(4-6-16)17-12-23(21-20-17)18-13-22-9-7-15(18)8-10-22/h1-6,11-12,15,18H,7-10,13H2/t18-/m0/s1 |
| InChIKey | ZVBBLPYIXPIVPZ-SFHVURJKSA-N |
| XLogP | 3.94 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |