C24H27N5O4S — CID 150892676
3-[4-[4-[[4-(2-morpholin-4-ylethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione (PubChem CID 150892676) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is 3-[4-[4-[[4-(2-morpholin-4-ylethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-[[4-(2-morpholin-4-ylethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 150892676 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 3-[4-[4-[[4-(2-morpholin-4-ylethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cc(-c3cscc3OCc3ccc(CCN4CCOCC4)cc3)nn2)C(=O)N1 |
| InChI | InChI=1S/C24H27N5O4S/c30-23-6-5-21(24(31)25-23)29-13-20(26-27-29)19-15-34-16-22(19)33-14-18-3-1-17(2-4-18)7-8-28-9-11-32-12-10-28/h1-4,13,15-16,21H,5-12,14H2,(H,25,30,31) |
| InChIKey | KYIPTANZBFHHGN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|