C27H34N6O5S — CID 175493438
morpholine;3-[4-[4-[[3-(morpholin-4-ylmethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione (PubChem CID 175493438) has the molecular formula C27H34N6O5S and a molecular weight of 554.67 g/mol. Its IUPAC name is morpholine;3-[4-[4-[[3-(morpholin-4-ylmethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione.
| Compound Name | morpholine;3-[4-[4-[[3-(morpholin-4-ylmethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175493438 |
| Molecular Formula | C27H34N6O5S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | morpholine;3-[4-[4-[[3-(morpholin-4-ylmethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione |
| SMILES | C1COCCN1.O=C1CCC(n2cc(-c3cscc3OCc3cccc(CN4CCOCC4)c3)nn2)C(=O)N1 |
| InChI | InChI=1S/C23H25N5O4S.C4H9NO/c29-22-5-4-20(23(30)24-22)28-12-19(25-26-28)18-14-33-15-21(18)32-13-17-3-1-2-16(10-17)11-27-6-8-31-9-7-27;1-3-6-4-2-5-1/h1-3,10,12,14-15,20H,4-9,11,13H2,(H,24,29,30);5H,1-4H2 |
| InChIKey | KREASTPEVYKGAZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|