C11H10N4O2S — CID 150360407
3-(4-thiophen-2-yltriazol-1-yl)piperidine-2,6-dione (PubChem CID 150360407) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is 3-(4-thiophen-2-yltriazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-thiophen-2-yltriazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 150360407 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3-(4-thiophen-2-yltriazol-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cc(-c3cccs3)nn2)C(=O)N1 |
| InChI | InChI=1S/C11H10N4O2S/c16-10-4-3-8(11(17)12-10)15-6-7(13-14-15)9-2-1-5-18-9/h1-2,5-6,8H,3-4H2,(H,12,16,17) |
| InChIKey | GVPCOFMAPDQIMI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|