C24H28ClN5O3S — CID 153329201
3-[4-[4-[[4-(piperidin-1-ylmethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 153329201) has the molecular formula C24H28ClN5O3S and a molecular weight of 502.04 g/mol. Its IUPAC name is 3-[4-[4-[[4-(piperidin-1-ylmethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[4-[4-[[4-(piperidin-1-ylmethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 153329201 |
| Molecular Formula | C24H28ClN5O3S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 3-[4-[4-[[4-(piperidin-1-ylmethyl)phenyl]methoxy]thiophen-3-yl]triazol-1-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(n2cc(-c3cscc3OCc3ccc(CN4CCCCC4)cc3)nn2)C(=O)N1 |
| InChI | InChI=1S/C24H27N5O3S.ClH/c30-23-9-8-21(24(31)25-23)29-13-20(26-27-29)19-15-33-16-22(19)32-14-18-6-4-17(5-7-18)12-28-10-2-1-3-11-28;/h4-7,13,15-16,21H,1-3,8-12,14H2,(H,25,30,31);1H |
| InChIKey | ZKADAAVXJWMTBB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|