C16H15N5O3 — CID 132542943
3-[4-[(3-oxo-1H-isoindol-2-yl)methyl]triazol-1-yl]piperidine-2,6-dione (PubChem CID 132542943) has the molecular formula C16H15N5O3 and a molecular weight of 325.33 g/mol. Its IUPAC name is 3-[4-[(3-oxo-1H-isoindol-2-yl)methyl]triazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[(3-oxo-1H-isoindol-2-yl)methyl]triazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 132542943 |
| Molecular Formula | C16H15N5O3 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 3-[4-[(3-oxo-1H-isoindol-2-yl)methyl]triazol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2cc(CN3Cc4ccccc4C3=O)nn2)C(=O)N1 |
| InChI | InChI=1S/C16H15N5O3/c22-14-6-5-13(15(23)17-14)21-9-11(18-19-21)8-20-7-10-3-1-2-4-12(10)16(20)24/h1-4,9,13H,5-8H2,(H,17,22,23) |
| InChIKey | ZHJMGZVTNLMTDS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|