C22H25N7O4 — CID 167734523
4-[[4-[4-(aminomethyl)triazol-1-yl]piperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167734523) has the molecular formula C22H25N7O4 and a molecular weight of 451.49 g/mol. Its IUPAC name is 4-[[4-[4-(aminomethyl)triazol-1-yl]piperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[4-[4-(aminomethyl)triazol-1-yl]piperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167734523 |
| Molecular Formula | C22H25N7O4 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 4-[[4-[4-(aminomethyl)triazol-1-yl]piperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | NCc1cn(C2CCN(Cc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)nn1 |
| InChI | InChI=1S/C22H25N7O4/c23-10-14-12-28(26-25-14)15-6-8-27(9-7-15)11-13-2-1-3-16-19(13)22(33)29(21(16)32)17-4-5-18(30)24-20(17)31/h1-3,12,15,17H,4-11,23H2,(H,24,30,31) |
| InChIKey | PSFKPVHRDAFUBO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 143.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|