C19H14F6N4O2 — CID 169133685
(11S)-5-[3,5-bis(trifluoromethyl)phenyl]-1,4,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-2,10-dione (PubChem CID 169133685) has the molecular formula C19H14F6N4O2 and a molecular weight of 444.34 g/mol. Its IUPAC name is (11S)-5-[3,5-bis(trifluoromethyl)phenyl]-1,4,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-2,10-dione.
| Compound Name | (11S)-5-[3,5-bis(trifluoromethyl)phenyl]-1,4,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-2,10-dione |
|---|---|
| PubChem CID | 169133685 |
| Molecular Formula | C19H14F6N4O2 |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (11S)-5-[3,5-bis(trifluoromethyl)phenyl]-1,4,9,13-tetrazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-2,10-dione |
| SMILES | O=C1Nc2ccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nc2C(=O)N2CCNC[C@@H]12 |
| InChI | InChI=1S/C19H14F6N4O2/c20-18(21,22)10-5-9(6-11(7-10)19(23,24)25)12-1-2-13-15(27-12)17(31)29-4-3-26-8-14(29)16(30)28-13/h1-2,5-7,14,26H,3-4,8H2,(H,28,30)/t14-/m0/s1 |
| InChIKey | MEEKTYQBSAGSTI-AWEZNQCLSA-N |
| XLogP | 3.15 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |