C22H17F6N3O — CID 58874526
[2-[3,5-bis(trifluoromethyl)phenyl]quinolin-6-yl]-piperazin-1-ylmethanone (PubChem CID 58874526) has the molecular formula C22H17F6N3O and a molecular weight of 453.39 g/mol. Its IUPAC name is [2-[3,5-bis(trifluoromethyl)phenyl]quinolin-6-yl]-piperazin-1-ylmethanone.
| Compound Name | [2-[3,5-bis(trifluoromethyl)phenyl]quinolin-6-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 58874526 |
| Molecular Formula | C22H17F6N3O |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | [2-[3,5-bis(trifluoromethyl)phenyl]quinolin-6-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1ccc2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2c1)N1CCNCC1 |
| InChI | InChI=1S/C22H17F6N3O/c23-21(24,25)16-10-15(11-17(12-16)22(26,27)28)19-3-1-13-9-14(2-4-18(13)30-19)20(32)31-7-5-29-6-8-31/h1-4,9-12,29H,5-8H2 |
| InChIKey | QFNTVAMDGLLBIP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |