About methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate
methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate (PubChem CID 58874793) has the molecular formula C24H14F6N2O3S
and a molecular weight of 524.44 g/mol. Its IUPAC name is methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate |
| PubChem CID | 58874793 |
| Molecular Formula | C24H14F6N2O3S |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1ccc2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2c1 |
| InChI | InChI=1S/C24H14F6N2O3S/c1-35-22(34)20-19(6-7-36-20)32-21(33)13-3-5-17-12(8-13)2-4-18(31-17)14-9-15(23(25,26)27)11-16(10-14)24(28,29)30/h2-11H,1H3,(H,32,33) |
| InChIKey | UWDKLTCNDSSJOU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate?
The IUPAC name of methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate (CID 58874793) is methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate?
The canonical SMILES for methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate is COC(=O)c1sccc1NC(=O)c1ccc2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2c1.
What is the InChIKey of methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate?
The InChIKey is UWDKLTCNDSSJOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14F6N2O3S/c1-35-22(34)20-19(6-7-36-20)32-21(33)13-3-5-17-12(8-13)2-4-18(31-17)14-9-15(23(25,26)27)11-16(10-14)24(28,29)30/h2-11H,1H3,(H,32,33).
What are the key properties of methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate?
methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate has a molecular weight of 524.44 g/mol, XLogP of 7.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-[3,5-bis(trifluoromethyl)phenyl]quinoline-6-carbonyl]amino]thiophene-2-carboxylate is sourced from PubChem (CID 58874793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).