C13H11NO4S — CID 43112154
methyl 3-[(4-hydroxybenzoyl)amino]thiophene-2-carboxylate (PubChem CID 43112154) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is methyl 3-[(4-hydroxybenzoyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(4-hydroxybenzoyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43112154 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | methyl 3-[(4-hydroxybenzoyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H11NO4S/c1-18-13(17)11-10(6-7-19-11)14-12(16)8-2-4-9(15)5-3-8/h2-7,15H,1H3,(H,14,16) |
| InChIKey | MPKXOWBPABLIED-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |