C22H17N3O4S — CID 36670505
methyl 3-[[4-(2-methyl-4-oxoquinazolin-3-yl)benzoyl]amino]thiophene-2-carboxylate (PubChem CID 36670505) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is methyl 3-[[4-(2-methyl-4-oxoquinazolin-3-yl)benzoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[4-(2-methyl-4-oxoquinazolin-3-yl)benzoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 36670505 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | methyl 3-[[4-(2-methyl-4-oxoquinazolin-3-yl)benzoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1ccc(-n2c(C)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C22H17N3O4S/c1-13-23-17-6-4-3-5-16(17)21(27)25(13)15-9-7-14(8-10-15)20(26)24-18-11-12-30-19(18)22(28)29-2/h3-12H,1-2H3,(H,24,26) |
| InChIKey | HRLMFBYMCCTJLH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |