C23H16F3N3O2 — CID 39776766
4-(2-methyl-4-oxoquinazolin-3-yl)-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 39776766) has the molecular formula C23H16F3N3O2 and a molecular weight of 423.39 g/mol. Its IUPAC name is 4-(2-methyl-4-oxoquinazolin-3-yl)-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(2-methyl-4-oxoquinazolin-3-yl)-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 39776766 |
| Molecular Formula | C23H16F3N3O2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-(2-methyl-4-oxoquinazolin-3-yl)-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1nc2ccccc2c(=O)n1-c1ccc(C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H16F3N3O2/c1-14-27-20-5-3-2-4-19(20)22(31)29(14)18-12-6-15(7-13-18)21(30)28-17-10-8-16(9-11-17)23(24,25)26/h2-13H,1H3,(H,28,30) |
| InChIKey | DNUNREHSGBMQTI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |