C23H18IN3O2 — CID 46809727
N-(3-iodo-4-methylphenyl)-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide (PubChem CID 46809727) has the molecular formula C23H18IN3O2 and a molecular weight of 495.32 g/mol. Its IUPAC name is N-(3-iodo-4-methylphenyl)-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide.
| Compound Name | N-(3-iodo-4-methylphenyl)-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
|---|---|
| PubChem CID | 46809727 |
| Molecular Formula | C23H18IN3O2 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | N-(3-iodo-4-methylphenyl)-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1I |
| InChI | InChI=1S/C23H18IN3O2/c1-14-7-10-17(13-20(14)24)26-22(28)16-8-11-18(12-9-16)27-15(2)25-21-6-4-3-5-19(21)23(27)29/h3-13H,1-2H3,(H,26,28) |
| InChIKey | OTXLFHKYPDRWIQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|