C26H25N3O2 — CID 46565875
N-[1-(2,5-dimethylphenyl)ethyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide (PubChem CID 46565875) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[1-(2,5-dimethylphenyl)ethyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide.
| Compound Name | N-[1-(2,5-dimethylphenyl)ethyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
|---|---|
| PubChem CID | 46565875 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[1-(2,5-dimethylphenyl)ethyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
| SMILES | Cc1ccc(C)c(C(C)NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)c1 |
| InChI | InChI=1S/C26H25N3O2/c1-16-9-10-17(2)23(15-16)18(3)27-25(30)20-11-13-21(14-12-20)29-19(4)28-24-8-6-5-7-22(24)26(29)31/h5-15,18H,1-4H3,(H,27,30) |
| InChIKey | ZUWGRPSBWINNBA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |