C28H22N4O4 — CID 55661317
N-[2-(4-methoxyphenoxy)-3-pyridinyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide (PubChem CID 55661317) has the molecular formula C28H22N4O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)-3-pyridinyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide.
| Compound Name | N-[2-(4-methoxyphenoxy)-3-pyridinyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
|---|---|
| PubChem CID | 55661317 |
| Molecular Formula | C28H22N4O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)-3-pyridinyl]-4-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
| SMILES | COc1ccc(Oc2ncccc2NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C28H22N4O4/c1-18-30-24-7-4-3-6-23(24)28(34)32(18)20-11-9-19(10-12-20)26(33)31-25-8-5-17-29-27(25)36-22-15-13-21(35-2)14-16-22/h3-17H,1-2H3,(H,31,33) |
| InChIKey | RQAJVOBWDCNWJZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |