C25H17F3N2O3 — CID 59711001
methyl 2-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]quinoline-6-carboxylate (PubChem CID 59711001) has the molecular formula C25H17F3N2O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is methyl 2-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]quinoline-6-carboxylate.
| Compound Name | methyl 2-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 59711001 |
| Molecular Formula | C25H17F3N2O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | methyl 2-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]quinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(NC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)ccc2c1 |
| InChI | InChI=1S/C25H17F3N2O3/c1-33-24(32)17-8-12-21-16(14-17)9-13-22(29-21)30-23(31)20-5-3-2-4-19(20)15-6-10-18(11-7-15)25(26,27)28/h2-14H,1H3,(H,29,30,31) |
| InChIKey | XUOYKEZNUDNKOQ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |