C19H15ClF3N3O2 — CID 169133758
(4aS)-9-[3-chloro-5-(trifluoromethyl)phenyl]-1,2,3,4,4a,6-hexahydropyrazino[2,1-c][1,4]benzodiazepine-5,11-dione (PubChem CID 169133758) has the molecular formula C19H15ClF3N3O2 and a molecular weight of 409.80 g/mol. Its IUPAC name is (4aS)-9-[3-chloro-5-(trifluoromethyl)phenyl]-1,2,3,4,4a,6-hexahydropyrazino[2,1-c][1,4]benzodiazepine-5,11-dione.
| Compound Name | (4aS)-9-[3-chloro-5-(trifluoromethyl)phenyl]-1,2,3,4,4a,6-hexahydropyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
|---|---|
| PubChem CID | 169133758 |
| Molecular Formula | C19H15ClF3N3O2 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (4aS)-9-[3-chloro-5-(trifluoromethyl)phenyl]-1,2,3,4,4a,6-hexahydropyrazino[2,1-c][1,4]benzodiazepine-5,11-dione |
| SMILES | O=C1Nc2ccc(-c3cc(Cl)cc(C(F)(F)F)c3)cc2C(=O)N2CCNC[C@@H]12 |
| InChI | InChI=1S/C19H15ClF3N3O2/c20-13-6-11(5-12(8-13)19(21,22)23)10-1-2-15-14(7-10)18(28)26-4-3-24-9-16(26)17(27)25-15/h1-2,5-8,16,24H,3-4,9H2,(H,25,27)/t16-/m0/s1 |
| InChIKey | REXMNXOJMWLOPI-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |