C10H12ClFN4O — CID 167438879
(10S)-4-fluoro-1,5,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one;hydrochloride (PubChem CID 167438879) has the molecular formula C10H12ClFN4O and a molecular weight of 258.68 g/mol. Its IUPAC name is (10S)-4-fluoro-1,5,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one;hydrochloride.
| Compound Name | (10S)-4-fluoro-1,5,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one;hydrochloride |
|---|---|
| PubChem CID | 167438879 |
| Molecular Formula | C10H12ClFN4O |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (10S)-4-fluoro-1,5,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one;hydrochloride |
| SMILES | Cl.O=C1Nc2cnc(F)cc2N2CCNC[C@@H]12 |
| InChI | InChI=1S/C10H11FN4O.ClH/c11-9-3-7-6(4-13-9)14-10(16)8-5-12-1-2-15(7)8;/h3-4,8,12H,1-2,5H2,(H,14,16);1H/t8-;/m0./s1 |
| InChIKey | CPDWJMGGNWNIGX-QRPNPIFTSA-N |
| XLogP | 0.37 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|