C12H14ClN3O — CID 84634517
7-chloro-9-methyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoxalin-5-one (PubChem CID 84634517) has the molecular formula C12H14ClN3O and a molecular weight of 251.72 g/mol. Its IUPAC name is 7-chloro-9-methyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoxalin-5-one.
| Compound Name | 7-chloro-9-methyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoxalin-5-one |
|---|---|
| PubChem CID | 84634517 |
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.72 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 7-chloro-9-methyl-1,2,3,4,4a,6-hexahydropyrazino[1,2-a]quinoxalin-5-one |
| SMILES | Cc1cc(Cl)c2c(c1)N1CCNCC1C(=O)N2 |
| InChI | InChI=1S/C12H14ClN3O/c1-7-4-8(13)11-9(5-7)16-3-2-14-6-10(16)12(17)15-11/h4-5,10,14H,2-3,6H2,1H3,(H,15,17) |
| InChIKey | PQSJPLUFTCADJY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.72 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |